C42H30N4 — CID 19020129
1,4,5-triphenyl-2-(1,4,5-triphenylimidazol-2-yl)imidazole (PubChem CID 19020129) has the molecular formula C42H30N4 and a molecular weight of 590.73 g/mol. Its IUPAC name is 1,4,5-triphenyl-2-(1,4,5-triphenylimidazol-2-yl)imidazole.
| Compound Name | 1,4,5-triphenyl-2-(1,4,5-triphenylimidazol-2-yl)imidazole |
|---|---|
| PubChem CID | 19020129 |
| Molecular Formula | C42H30N4 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 1,4,5-triphenyl-2-(1,4,5-triphenylimidazol-2-yl)imidazole |
| SMILES | c1ccc(-c2nc(-c3nc(-c4ccccc4)c(-c4ccccc4)n3-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C42H30N4/c1-7-19-31(20-8-1)37-39(33-23-11-3-12-24-33)45(35-27-15-5-16-28-35)41(43-37)42-44-38(32-21-9-2-10-22-32)40(34-25-13-4-14-26-34)46(42)36-29-17-6-18-30-36/h1-30H |
| InChIKey | XHBPYQPGOSUPNH-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |