C29H23BrN2 — CID 122207157
2-(4-bromophenyl)-1-(3,4-dimethylphenyl)-4,5-diphenylimidazole (PubChem CID 122207157) has the molecular formula C29H23BrN2 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(3,4-dimethylphenyl)-4,5-diphenylimidazole.
| Compound Name | 2-(4-bromophenyl)-1-(3,4-dimethylphenyl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 122207157 |
| Molecular Formula | C29H23BrN2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 2-(4-bromophenyl)-1-(3,4-dimethylphenyl)-4,5-diphenylimidazole |
| SMILES | Cc1ccc(-n2c(-c3ccc(Br)cc3)nc(-c3ccccc3)c2-c2ccccc2)cc1C |
| InChI | InChI=1S/C29H23BrN2/c1-20-13-18-26(19-21(20)2)32-28(23-11-7-4-8-12-23)27(22-9-5-3-6-10-22)31-29(32)24-14-16-25(30)17-15-24/h3-19H,1-2H3 |
| InChIKey | DXISKZZNFWRFRC-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |