C32H29BN2O2 — CID 151783314
1-[3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,4,5-triphenylimidazole (PubChem CID 151783314) has the molecular formula C32H29BN2O2 and a molecular weight of 484.41 g/mol. Its IUPAC name is 1-[3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,4,5-triphenylimidazole.
| Compound Name | 1-[3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,4,5-triphenylimidazole |
|---|---|
| PubChem CID | 151783314 |
| Molecular Formula | C32H29BN2O2 |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | 1-[3-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)phenyl]-2,4,5-triphenylimidazole |
| SMILES | CC1(C)COB(c2cccc(-n3c(-c4ccccc4)nc(-c4ccccc4)c3-c3ccccc3)c2)OC1 |
| InChI | InChI=1S/C32H29BN2O2/c1-32(2)22-36-33(37-23-32)27-19-12-20-28(21-27)35-30(25-15-8-4-9-16-25)29(24-13-6-3-7-14-24)34-31(35)26-17-10-5-11-18-26/h3-21H,22-23H2,1-2H3 |
| InChIKey | RVBOMAATJMPQGY-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|