C25H24N2 — CID 142519119
1-tert-butyl-2,4,5-triphenylimidazole (PubChem CID 142519119) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-tert-butyl-2,4,5-triphenylimidazole.
| Compound Name | 1-tert-butyl-2,4,5-triphenylimidazole |
|---|---|
| PubChem CID | 142519119 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-tert-butyl-2,4,5-triphenylimidazole |
| SMILES | CC(C)(C)n1c(-c2ccccc2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C25H24N2/c1-25(2,3)27-23(20-15-9-5-10-16-20)22(19-13-7-4-8-14-19)26-24(27)21-17-11-6-12-18-21/h4-18H,1-3H3 |
| InChIKey | OZTZBOKABSLJCO-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |