C17H11F3N2O — CID 59120436
2,3-diphenyl-6-(trifluoromethyl)pyrimidin-4-one (PubChem CID 59120436) has the molecular formula C17H11F3N2O and a molecular weight of 316.28 g/mol. Its IUPAC name is 2,3-diphenyl-6-(trifluoromethyl)pyrimidin-4-one.
| Compound Name | 2,3-diphenyl-6-(trifluoromethyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 59120436 |
| Molecular Formula | C17H11F3N2O |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 2,3-diphenyl-6-(trifluoromethyl)pyrimidin-4-one |
| SMILES | O=c1cc(C(F)(F)F)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C17H11F3N2O/c18-17(19,20)14-11-15(23)22(13-9-5-2-6-10-13)16(21-14)12-7-3-1-4-8-12/h1-11H |
| InChIKey | SXDHOZJPILDUEJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |