C21H21N3O — CID 15632926
2,3-diphenyl-6-piperidin-1-ylpyrimidin-4-one (PubChem CID 15632926) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 2,3-diphenyl-6-piperidin-1-ylpyrimidin-4-one.
| Compound Name | 2,3-diphenyl-6-piperidin-1-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 15632926 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 2,3-diphenyl-6-piperidin-1-ylpyrimidin-4-one |
| SMILES | O=c1cc(N2CCCCC2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O/c25-20-16-19(23-14-8-3-9-15-23)22-21(17-10-4-1-5-11-17)24(20)18-12-6-2-7-13-18/h1-2,4-7,10-13,16H,3,8-9,14-15H2 |
| InChIKey | GCMITFBVXSDWHC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |