C18H20N4 — CID 13114271
4-methyl-6-phenyl-2-piperidin-1-ylimidazo[1,5-a]pyrimidine (PubChem CID 13114271) has the molecular formula C18H20N4 and a molecular weight of 292.39 g/mol. Its IUPAC name is 4-methyl-6-phenyl-2-piperidin-1-ylimidazo[1,5-a]pyrimidine.
| Compound Name | 4-methyl-6-phenyl-2-piperidin-1-ylimidazo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 13114271 |
| Molecular Formula | C18H20N4 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 4-methyl-6-phenyl-2-piperidin-1-ylimidazo[1,5-a]pyrimidine |
| SMILES | Cc1cc(N2CCCCC2)nc2cnc(-c3ccccc3)n12 |
| InChI | InChI=1S/C18H20N4/c1-14-12-16(21-10-6-3-7-11-21)20-17-13-19-18(22(14)17)15-8-4-2-5-9-15/h2,4-5,8-9,12-13H,3,6-7,10-11H2,1H3 |
| InChIKey | ZNJMEDMTIUPCPL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |