C17H21N3 — CID 16876766
1-(2-methyl-6-phenylpyrimidin-4-yl)azepane (PubChem CID 16876766) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 1-(2-methyl-6-phenylpyrimidin-4-yl)azepane.
| Compound Name | 1-(2-methyl-6-phenylpyrimidin-4-yl)azepane |
|---|---|
| PubChem CID | 16876766 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(2-methyl-6-phenylpyrimidin-4-yl)azepane |
| SMILES | Cc1nc(-c2ccccc2)cc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C17H21N3/c1-14-18-16(15-9-5-4-6-10-15)13-17(19-14)20-11-7-2-3-8-12-20/h4-6,9-10,13H,2-3,7-8,11-12H2,1H3 |
| InChIKey | HQJHQGMMCORQKS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |