C20H27N5 — CID 112934083
2-(4-ethylpiperazin-1-yl)-4-phenyl-6-pyrrolidin-1-ylpyrimidine (PubChem CID 112934083) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-4-phenyl-6-pyrrolidin-1-ylpyrimidine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-4-phenyl-6-pyrrolidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 112934083 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-4-phenyl-6-pyrrolidin-1-ylpyrimidine |
| SMILES | CCN1CCN(c2nc(-c3ccccc3)cc(N3CCCC3)n2)CC1 |
| InChI | InChI=1S/C20H27N5/c1-2-23-12-14-25(15-13-23)20-21-18(17-8-4-3-5-9-17)16-19(22-20)24-10-6-7-11-24/h3-5,8-9,16H,2,6-7,10-15H2,1H3 |
| InChIKey | WJMIOMMRXWROQL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |