C24H29N5 — CID 112936435
4-(4-ethylpiperazin-1-yl)-6-phenyl-N-(1-phenylethyl)pyrimidin-2-amine (PubChem CID 112936435) has the molecular formula C24H29N5 and a molecular weight of 387.53 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-6-phenyl-N-(1-phenylethyl)pyrimidin-2-amine.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-6-phenyl-N-(1-phenylethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112936435 |
| Molecular Formula | C24H29N5 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-6-phenyl-N-(1-phenylethyl)pyrimidin-2-amine |
| SMILES | CCN1CCN(c2cc(-c3ccccc3)nc(NC(C)c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H29N5/c1-3-28-14-16-29(17-15-28)23-18-22(21-12-8-5-9-13-21)26-24(27-23)25-19(2)20-10-6-4-7-11-20/h4-13,18-19H,3,14-17H2,1-2H3,(H,25,26,27) |
| InChIKey | JVXZSZZHYDSIFG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |