C21H29N5O2 — CID 112933843
ethyl 4-[2-(2-methylpropylamino)-6-phenylpyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112933843) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is ethyl 4-[2-(2-methylpropylamino)-6-phenylpyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(2-methylpropylamino)-6-phenylpyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112933843 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | ethyl 4-[2-(2-methylpropylamino)-6-phenylpyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(-c3ccccc3)nc(NCC(C)C)n2)CC1 |
| InChI | InChI=1S/C21H29N5O2/c1-4-28-21(27)26-12-10-25(11-13-26)19-14-18(17-8-6-5-7-9-17)23-20(24-19)22-15-16(2)3/h5-9,14,16H,4,10-13,15H2,1-3H3,(H,22,23,24) |
| InChIKey | BTCZLAMXMVSMJF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |