C21H27N5O3 — CID 109369256
ethyl 4-[2-methyl-6-(1-phenylethylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 109369256) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 4-[2-methyl-6-(1-phenylethylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-methyl-6-(1-phenylethylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109369256 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | ethyl 4-[2-methyl-6-(1-phenylethylcarbamoyl)pyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(C(=O)NC(C)c3ccccc3)nc(C)n2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-4-29-21(28)26-12-10-25(11-13-26)19-14-18(23-16(3)24-19)20(27)22-15(2)17-8-6-5-7-9-17/h5-9,14-15H,4,10-13H2,1-3H3,(H,22,27) |
| InChIKey | RVQHBDHQVLNFQS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |