C19H23N5O2 — CID 109367441
6-(4-formylpiperazin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidine-4-carboxamide (PubChem CID 109367441) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-(4-formylpiperazin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(4-formylpiperazin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109367441 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 6-(4-formylpiperazin-1-yl)-2-methyl-N-(1-phenylethyl)pyrimidine-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC(C)c2ccccc2)cc(N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C19H23N5O2/c1-14(16-6-4-3-5-7-16)20-19(26)17-12-18(22-15(2)21-17)24-10-8-23(13-25)9-11-24/h3-7,12-14H,8-11H2,1-2H3,(H,20,26) |
| InChIKey | YIDHKSZYZUAXFS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|