C20H25N5O2 — CID 109367506
6-(4-formylpiperazin-1-yl)-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidine-4-carboxamide (PubChem CID 109367506) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 6-(4-formylpiperazin-1-yl)-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(4-formylpiperazin-1-yl)-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109367506 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 6-(4-formylpiperazin-1-yl)-2-methyl-N-(2,4,6-trimethylphenyl)pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C)c(NC(=O)c2cc(N3CCN(C=O)CC3)nc(C)n2)c(C)c1 |
| InChI | InChI=1S/C20H25N5O2/c1-13-9-14(2)19(15(3)10-13)23-20(27)17-11-18(22-16(4)21-17)25-7-5-24(12-26)6-8-25/h9-12H,5-8H2,1-4H3,(H,23,27) |
| InChIKey | OISCHASHTVGWSY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|