C22H23F2N5 — CID 112936484
N-(2,6-difluorophenyl)-4-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-2-amine (PubChem CID 112936484) has the molecular formula C22H23F2N5 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-2-amine.
| Compound Name | N-(2,6-difluorophenyl)-4-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112936484 |
| Molecular Formula | C22H23F2N5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-2-amine |
| SMILES | CCN1CCN(c2cc(-c3ccccc3)nc(Nc3c(F)cccc3F)n2)CC1 |
| InChI | InChI=1S/C22H23F2N5/c1-2-28-11-13-29(14-12-28)20-15-19(16-7-4-3-5-8-16)25-22(26-20)27-21-17(23)9-6-10-18(21)24/h3-10,15H,2,11-14H2,1H3,(H,25,26,27) |
| InChIKey | CUTJAPOMXAFMIA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |