C20H18F2N4O — CID 112935473
N-(2,6-difluorophenyl)-4-morpholin-4-yl-6-phenylpyrimidin-2-amine (PubChem CID 112935473) has the molecular formula C20H18F2N4O and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-4-morpholin-4-yl-6-phenylpyrimidin-2-amine.
| Compound Name | N-(2,6-difluorophenyl)-4-morpholin-4-yl-6-phenylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112935473 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(2,6-difluorophenyl)-4-morpholin-4-yl-6-phenylpyrimidin-2-amine |
| SMILES | Fc1cccc(F)c1Nc1nc(-c2ccccc2)cc(N2CCOCC2)n1 |
| InChI | InChI=1S/C20H18F2N4O/c21-15-7-4-8-16(22)19(15)25-20-23-17(14-5-2-1-3-6-14)13-18(24-20)26-9-11-27-12-10-26/h1-8,13H,9-12H2,(H,23,24,25) |
| InChIKey | NQCQAAOTBRGKJH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |