C22H23FN4 — CID 112934497
N-[(4-fluorophenyl)methyl]-4-phenyl-6-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112934497) has the molecular formula C22H23FN4 and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-phenyl-6-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-phenyl-6-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112934497 |
| Molecular Formula | C22H23FN4 |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-phenyl-6-piperidin-1-ylpyrimidin-2-amine |
| SMILES | Fc1ccc(CNc2nc(-c3ccccc3)cc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H23FN4/c23-19-11-9-17(10-12-19)16-24-22-25-20(18-7-3-1-4-8-18)15-21(26-22)27-13-5-2-6-14-27/h1,3-4,7-12,15H,2,5-6,13-14,16H2,(H,24,25,26) |
| InChIKey | MYPGFUWXYOYUBA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |