C23H33N5 — CID 112936505
N-cycloheptyl-2-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-4-amine (PubChem CID 112936505) has the molecular formula C23H33N5 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-cycloheptyl-2-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-4-amine.
| Compound Name | N-cycloheptyl-2-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112936505 |
| Molecular Formula | C23H33N5 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | N-cycloheptyl-2-(4-ethylpiperazin-1-yl)-6-phenylpyrimidin-4-amine |
| SMILES | CCN1CCN(c2nc(NC3CCCCCC3)cc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H33N5/c1-2-27-14-16-28(17-15-27)23-25-21(19-10-6-5-7-11-19)18-22(26-23)24-20-12-8-3-4-9-13-20/h5-7,10-11,18,20H,2-4,8-9,12-17H2,1H3,(H,24,25,26) |
| InChIKey | GRYLENYMATYJTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |