C18H18N4 — CID 14241253
4-phenyl-2-piperidin-1-ylpyrido[2,3-d]pyridazine (PubChem CID 14241253) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is 4-phenyl-2-piperidin-1-ylpyrido[2,3-d]pyridazine.
| Compound Name | 4-phenyl-2-piperidin-1-ylpyrido[2,3-d]pyridazine |
|---|---|
| PubChem CID | 14241253 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 4-phenyl-2-piperidin-1-ylpyrido[2,3-d]pyridazine |
| SMILES | c1ccc(-c2cc(N3CCCCC3)nc3cnncc23)cc1 |
| InChI | InChI=1S/C18H18N4/c1-3-7-14(8-4-1)15-11-18(22-9-5-2-6-10-22)21-17-13-20-19-12-16(15)17/h1,3-4,7-8,11-13H,2,5-6,9-10H2 |
| InChIKey | HBJNJQOONJNXKU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |