C11H17N3O — CID 67744616
2,3-dimethyl-6-piperidin-1-ylpyrimidin-4-one (PubChem CID 67744616) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 2,3-dimethyl-6-piperidin-1-ylpyrimidin-4-one.
| Compound Name | 2,3-dimethyl-6-piperidin-1-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 67744616 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 2,3-dimethyl-6-piperidin-1-ylpyrimidin-4-one |
| SMILES | Cc1nc(N2CCCCC2)cc(=O)n1C |
| InChI | InChI=1S/C11H17N3O/c1-9-12-10(8-11(15)13(9)2)14-6-4-3-5-7-14/h8H,3-7H2,1-2H3 |
| InChIKey | JADVCMYHJAKUFA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |