C18H20N2 — CID 130368704
4,4-dimethyl-3-phenyl-2,3a-dihydro-1H-imidazo[1,2-a]indole (PubChem CID 130368704) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4,4-dimethyl-3-phenyl-2,3a-dihydro-1H-imidazo[1,2-a]indole.
| Compound Name | 4,4-dimethyl-3-phenyl-2,3a-dihydro-1H-imidazo[1,2-a]indole |
|---|---|
| PubChem CID | 130368704 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 4,4-dimethyl-3-phenyl-2,3a-dihydro-1H-imidazo[1,2-a]indole |
| SMILES | CC1(C)c2ccccc2N2CCN(c3ccccc3)C21 |
| InChI | InChI=1S/C18H20N2/c1-18(2)15-10-6-7-11-16(15)20-13-12-19(17(18)20)14-8-4-3-5-9-14/h3-11,17H,12-13H2,1-2H3 |
| InChIKey | IPVSBRFYNCABLJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |