C16H15NS — CID 14113261
3,3-dimethyl-1-phenylindole-2-thione (PubChem CID 14113261) has the molecular formula C16H15NS and a molecular weight of 253.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-phenylindole-2-thione.
| Compound Name | 3,3-dimethyl-1-phenylindole-2-thione |
|---|---|
| PubChem CID | 14113261 |
| Molecular Formula | C16H15NS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 3,3-dimethyl-1-phenylindole-2-thione |
| SMILES | CC1(C)C(=S)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H15NS/c1-16(2)13-10-6-7-11-14(13)17(15(16)18)12-8-4-3-5-9-12/h3-11H,1-2H3 |
| InChIKey | LHJCAADBCAUINH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|