C21H32N2 — CID 164783131
1-(3,3,4,4,5,5-hexamethylcyclohexyl)-3-phenyl-2H-imidazole (PubChem CID 164783131) has the molecular formula C21H32N2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5-hexamethylcyclohexyl)-3-phenyl-2H-imidazole.
| Compound Name | 1-(3,3,4,4,5,5-hexamethylcyclohexyl)-3-phenyl-2H-imidazole |
|---|---|
| PubChem CID | 164783131 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1-(3,3,4,4,5,5-hexamethylcyclohexyl)-3-phenyl-2H-imidazole |
| SMILES | CC1(C)CC(N2C=CN(c3ccccc3)C2)CC(C)(C)C1(C)C |
| InChI | InChI=1S/C21H32N2/c1-19(2)14-18(15-20(3,4)21(19,5)6)23-13-12-22(16-23)17-10-8-7-9-11-17/h7-13,18H,14-16H2,1-6H3 |
| InChIKey | WIODFPAHSWRWBV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |