C23H44F3NSi3 — CID 15202010
[[[ditert-butyl(fluoro)silyl]-[ditert-butyl(methyl)silyl]amino]-difluorosilyl]benzene (PubChem CID 15202010) has the molecular formula C23H44F3NSi3 and a molecular weight of 475.86 g/mol. Its IUPAC name is [[[ditert-butyl(fluoro)silyl]-[ditert-butyl(methyl)silyl]amino]-difluorosilyl]benzene.
| Compound Name | [[[ditert-butyl(fluoro)silyl]-[ditert-butyl(methyl)silyl]amino]-difluorosilyl]benzene |
|---|---|
| PubChem CID | 15202010 |
| Molecular Formula | C23H44F3NSi3 |
| Molecular Weight | 475.86 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | [[[ditert-butyl(fluoro)silyl]-[ditert-butyl(methyl)silyl]amino]-difluorosilyl]benzene |
| SMILES | CC(C)(C)[Si](C)(N([Si](F)(F)c1ccccc1)[Si](F)(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H44F3NSi3/c1-20(2,3)28(13,21(4,5)6)27(29(24,25)19-17-15-14-16-18-19)30(26,22(7,8)9)23(10,11)12/h14-18H,1-13H3 |
| InChIKey | FVBXDZFNBGDKOG-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.86 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|