C22H28Si — CID 11301658
tert-butyl-(cyclohexen-1-yl)-diphenylsilane (PubChem CID 11301658) has the molecular formula C22H28Si and a molecular weight of 320.55 g/mol. Its IUPAC name is tert-butyl-(cyclohexen-1-yl)-diphenylsilane.
| Compound Name | tert-butyl-(cyclohexen-1-yl)-diphenylsilane |
|---|---|
| PubChem CID | 11301658 |
| Molecular Formula | C22H28Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | tert-butyl-(cyclohexen-1-yl)-diphenylsilane |
| SMILES | CC(C)(C)[Si](C1=CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28Si/c1-22(2,3)23(19-13-7-4-8-14-19,20-15-9-5-10-16-20)21-17-11-6-12-18-21/h4-5,7-10,13-17H,6,11-12,18H2,1-3H3 |
| InChIKey | BUBSZWOLHZBTIU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|