About triphenylsilyl 2-(trifluoromethyl)prop-2-enoate
triphenylsilyl 2-(trifluoromethyl)prop-2-enoate (PubChem CID 163794375) has the molecular formula C22H17F3O2Si
and a molecular weight of 398.46 g/mol. Its IUPAC name is triphenylsilyl 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | triphenylsilyl 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 163794375 |
| Molecular Formula | C22H17F3O2Si |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | triphenylsilyl 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H17F3O2Si/c1-17(22(23,24)25)21(26)27-28(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H2 |
| InChIKey | MZNINMJMEOUJIW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze triphenylsilyl 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenylsilyl 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of triphenylsilyl 2-(trifluoromethyl)prop-2-enoate (CID 163794375) is triphenylsilyl 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for triphenylsilyl 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for triphenylsilyl 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)F.
What is the InChIKey of triphenylsilyl 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is MZNINMJMEOUJIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F3O2Si/c1-17(22(23,24)25)21(26)27-28(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H2.
What are the key properties of triphenylsilyl 2-(trifluoromethyl)prop-2-enoate?
triphenylsilyl 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 398.46 g/mol, XLogP of 3.32, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triphenylsilyl 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 163794375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).