C30H14F12O8 — CID 118017195
[1,6,8-tris[2-(trifluoromethyl)prop-2-enoyloxy]phenanthren-3-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 118017195) has the molecular formula C30H14F12O8 and a molecular weight of 730.41 g/mol. Its IUPAC name is [1,6,8-tris[2-(trifluoromethyl)prop-2-enoyloxy]phenanthren-3-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [1,6,8-tris[2-(trifluoromethyl)prop-2-enoyloxy]phenanthren-3-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 118017195 |
| Molecular Formula | C30H14F12O8 |
| Molecular Weight | 730.41 g/mol |
| Exact Mass | 730.05 |
| IUPAC Name | [1,6,8-tris[2-(trifluoromethyl)prop-2-enoyloxy]phenanthren-3-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)Oc1cc(OC(=O)C(=C)C(F)(F)F)c2ccc3c(OC(=O)C(=C)C(F)(F)F)cc(OC(=O)C(=C)C(F)(F)F)cc3c2c1)C(F)(F)F |
| InChI | InChI=1S/C30H14F12O8/c1-11(27(31,32)33)23(43)47-15-7-19-17(21(9-15)49-25(45)13(3)29(37,38)39)5-6-18-20(19)8-16(48-24(44)12(2)28(34,35)36)10-22(18)50-26(46)14(4)30(40,41)42/h5-10H,1-4H2 |
| InChIKey | YOXPTFMWSRWGEO-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.41 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|