C23H19F3O4 — CID 67472329
[9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 67472329) has the molecular formula C23H19F3O4 and a molecular weight of 416.40 g/mol. Its IUPAC name is [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 67472329 |
| Molecular Formula | C23H19F3O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)C(C)(C)c1cc(OC(=O)C(=C)C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C23H19F3O4/c1-12(2)20(27)29-14-6-8-16-17-9-7-15(30-21(28)13(3)23(24,25)26)11-19(17)22(4,5)18(16)10-14/h6-11H,1,3H2,2,4-5H3 |
| InChIKey | TVXPXSMHTMXLRW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|