About [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate
[9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 67472329) has the molecular formula C23H19F3O4
and a molecular weight of 416.40 g/mol. Its IUPAC name is [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 67472329 |
| Molecular Formula | C23H19F3O4 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(c1)C(C)(C)c1cc(OC(=O)C(=C)C(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C23H19F3O4/c1-12(2)20(27)29-14-6-8-16-17-9-7-15(30-21(28)13(3)23(24,25)26)11-19(17)22(4,5)18(16)10-14/h6-11H,1,3H2,2,4-5H3 |
| InChIKey | TVXPXSMHTMXLRW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate (CID 67472329) is [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate is C=C(C)C(=O)Oc1ccc2c(c1)C(C)(C)c1cc(OC(=O)C(=C)C(F)(F)F)ccc1-2.
What is the InChIKey of [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is TVXPXSMHTMXLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19F3O4/c1-12(2)20(27)29-14-6-8-16-17-9-7-15(30-21(28)13(3)23(24,25)26)11-19(17)22(4,5)18(16)10-14/h6-11H,1,3H2,2,4-5H3.
What are the key properties of [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate?
[9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 416.40 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [9,9-dimethyl-7-(2-methylprop-2-enoyloxy)fluoren-2-yl] 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 67472329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).