C25H18F6O2 — CID 118147467
[4-[4-(4-methylphenyl)-2,3-bis(trifluoromethyl)phenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 118147467) has the molecular formula C25H18F6O2 and a molecular weight of 464.41 g/mol. Its IUPAC name is [4-[4-(4-methylphenyl)-2,3-bis(trifluoromethyl)phenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-(4-methylphenyl)-2,3-bis(trifluoromethyl)phenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118147467 |
| Molecular Formula | C25H18F6O2 |
| Molecular Weight | 464.41 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [4-[4-(4-methylphenyl)-2,3-bis(trifluoromethyl)phenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(-c3ccc(C)cc3)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H18F6O2/c1-14(2)23(32)33-18-10-8-17(9-11-18)20-13-12-19(16-6-4-15(3)5-7-16)21(24(26,27)28)22(20)25(29,30)31/h4-13H,1H2,2-3H3 |
| InChIKey | SSGDKVIBGLQDRF-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.41 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|