C28H21F3O5S — CID 170022636
[4-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)dibenzothiophen-3-yl]phenyl] 2-methylprop-2-enoate (PubChem CID 170022636) has the molecular formula C28H21F3O5S and a molecular weight of 526.53 g/mol. Its IUPAC name is [4-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)dibenzothiophen-3-yl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)dibenzothiophen-3-yl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170022636 |
| Molecular Formula | C28H21F3O5S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [4-[4-methoxy-7-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)dibenzothiophen-3-yl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc3c(sc4c(C(F)(F)F)c(OC(=O)C(=C)C)ccc43)c2OC)cc1 |
| InChI | InChI=1S/C28H21F3O5S/c1-14(2)26(32)35-17-8-6-16(7-9-17)18-10-11-20-19-12-13-21(36-27(33)15(3)4)22(28(29,30)31)24(19)37-25(20)23(18)34-5/h6-13H,1,3H2,2,4-5H3 |
| InChIKey | VJUKNUNYJJIGTN-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|