C26H17F3O6 — CID 170035434
[4-[4-methoxy-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]phenyl] prop-2-enoate (PubChem CID 170035434) has the molecular formula C26H17F3O6 and a molecular weight of 482.41 g/mol. Its IUPAC name is [4-[4-methoxy-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]phenyl] prop-2-enoate.
| Compound Name | [4-[4-methoxy-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 170035434 |
| Molecular Formula | C26H17F3O6 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [4-[4-methoxy-7-prop-2-enoyloxy-6-(trifluoromethyl)dibenzofuran-3-yl]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2ccc3c(oc4c(C(F)(F)F)c(OC(=O)C=C)ccc43)c2OC)cc1 |
| InChI | InChI=1S/C26H17F3O6/c1-4-20(30)33-15-8-6-14(7-9-15)16-10-11-18-17-12-13-19(34-21(31)5-2)22(26(27,28)29)23(17)35-25(18)24(16)32-3/h4-13H,1-2H2,3H3 |
| InChIKey | OCKRHLRSTOVSGE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|