C22H14F6O6S — CID 170021571
[7-(2-methylprop-2-enoyloxy)-4,6-bis(trifluoromethoxy)dibenzothiophen-3-yl] 2-methylprop-2-enoate (PubChem CID 170021571) has the molecular formula C22H14F6O6S and a molecular weight of 520.40 g/mol. Its IUPAC name is [7-(2-methylprop-2-enoyloxy)-4,6-bis(trifluoromethoxy)dibenzothiophen-3-yl] 2-methylprop-2-enoate.
| Compound Name | [7-(2-methylprop-2-enoyloxy)-4,6-bis(trifluoromethoxy)dibenzothiophen-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170021571 |
| Molecular Formula | C22H14F6O6S |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | [7-(2-methylprop-2-enoyloxy)-4,6-bis(trifluoromethoxy)dibenzothiophen-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(sc3c(OC(F)(F)F)c(OC(=O)C(=C)C)ccc32)c1OC(F)(F)F |
| InChI | InChI=1S/C22H14F6O6S/c1-9(2)19(29)31-13-7-5-11-12-6-8-14(32-20(30)10(3)4)16(34-22(26,27)28)18(12)35-17(11)15(13)33-21(23,24)25/h5-8H,1,3H2,2,4H3 |
| InChIKey | UQOVJIDYOIQLKC-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|