C21H14F4O4S — CID 170024758
[6-fluoro-7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl] 2-methylprop-2-enoate (PubChem CID 170024758) has the molecular formula C21H14F4O4S and a molecular weight of 438.40 g/mol. Its IUPAC name is [6-fluoro-7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl] 2-methylprop-2-enoate.
| Compound Name | [6-fluoro-7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170024758 |
| Molecular Formula | C21H14F4O4S |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | [6-fluoro-7-(2-methylprop-2-enoyloxy)-4-(trifluoromethyl)dibenzothiophen-3-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc2c(sc3c(C(F)(F)F)c(OC(=O)C(=C)C)ccc32)c1F |
| InChI | InChI=1S/C21H14F4O4S/c1-9(2)19(26)28-13-7-5-11-12-6-8-14(29-20(27)10(3)4)16(22)18(12)30-17(11)15(13)21(23,24)25/h5-8H,1,3H2,2,4H3 |
| InChIKey | KLZDDSYYIXSLTJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|