C21H18F2OSi — CID 11727896
1,1-difluoroprop-1-en-2-yloxy(triphenyl)silane (PubChem CID 11727896) has the molecular formula C21H18F2OSi and a molecular weight of 352.46 g/mol. Its IUPAC name is 1,1-difluoroprop-1-en-2-yloxy(triphenyl)silane.
| Compound Name | 1,1-difluoroprop-1-en-2-yloxy(triphenyl)silane |
|---|---|
| PubChem CID | 11727896 |
| Molecular Formula | C21H18F2OSi |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1,1-difluoroprop-1-en-2-yloxy(triphenyl)silane |
| SMILES | CC(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)=C(F)F |
| InChI | InChI=1S/C21H18F2OSi/c1-17(21(22)23)24-25(18-11-5-2-6-12-18,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | KFJIDBHKMIHYSM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|