About hexaphenyltrisiloxane
hexaphenyltrisiloxane (PubChem CID 87857369) has the molecular formula C36H30O2Si3
and a molecular weight of 578.89 g/mol.
Molecular Properties
| Compound Name | hexaphenyltrisiloxane |
| PubChem CID | 87857369 |
| Molecular Formula | C36H30O2Si3 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | — |
| SMILES | c1ccc([Si](O[Si]O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H30O2Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32,33-23-11-3-12-24-33)37-39-38-41(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H |
| InChIKey | CMWRUTZCSFMXJQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze hexaphenyltrisiloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexaphenyltrisiloxane?
The IUPAC name of hexaphenyltrisiloxane (CID 87857369) is not available.
What is the SMILES notation for hexaphenyltrisiloxane?
The canonical SMILES for hexaphenyltrisiloxane is c1ccc([Si](O[Si]O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of hexaphenyltrisiloxane?
The InChIKey is CMWRUTZCSFMXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H30O2Si3/c1-7-19-31(20-8-1)40(32-21-9-2-10-22-32,33-23-11-3-12-24-33)37-39-38-41(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30H.
What are the key properties of hexaphenyltrisiloxane?
hexaphenyltrisiloxane has a molecular weight of 578.89 g/mol, XLogP of 3.89, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexaphenyltrisiloxane is sourced from PubChem (CID 87857369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).