C114H96O6Si6 — CID 102382950
[2,3,4,5,6-pentakis(triphenylsilyloxy)cyclohexyl]oxy-triphenylsilane (PubChem CID 102382950) has the molecular formula C114H96O6Si6 and a molecular weight of 1730.53 g/mol. Its IUPAC name is [2,3,4,5,6-pentakis(triphenylsilyloxy)cyclohexyl]oxy-triphenylsilane.
| Compound Name | [2,3,4,5,6-pentakis(triphenylsilyloxy)cyclohexyl]oxy-triphenylsilane |
|---|---|
| PubChem CID | 102382950 |
| Molecular Formula | C114H96O6Si6 |
| Molecular Weight | 1730.53 g/mol |
| Exact Mass | 1728.58 |
| IUPAC Name | [2,3,4,5,6-pentakis(triphenylsilyloxy)cyclohexyl]oxy-triphenylsilane |
| SMILES | c1ccc([Si](OC2C(O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)C(O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)C(O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)C(O[Si](c3ccccc3)(c3ccccc3)c3ccccc3)C2O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C114H96O6Si6/c1-19-55-91(56-20-1)121(92-57-21-2-22-58-92,93-59-23-3-24-60-93)115-109-110(116-122(94-61-25-4-26-62-94,95-63-27-5-28-64-95)96-65-29-6-30-66-96)112(118-124(100-73-37-10-38-74-100,101-75-39-11-40-76-101)102-77-41-12-42-78-102)114(120-126(106-85-49-16-50-86-106,107-87-51-17-52-88-107)108-89-53-18-54-90-108)113(119-125(103-79-43-13-44-80-103,104-81-45-14-46-82-104)105-83-47-15-48-84-105)111(109)117-123(97-67-31-7-32-68-97,98-69-33-8-34-70-98)99-71-35-9-36-72-99/h1-90,109-114H |
| InChIKey | MGIMZEUCHRWFBI-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 126 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1730.53 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|