About CID 11981400
CID 11981400 (PubChem CID 11981400) has the molecular formula C42H42O2Si3
and a molecular weight of 663.05 g/mol.
Molecular Properties
| Compound Name | CID 11981400 |
| PubChem CID | 11981400 |
| Molecular Formula | C42H42O2Si3 |
| Molecular Weight | 663.05 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | — |
| SMILES | c1ccc(C[Si](Cc2ccccc2)(Cc2ccccc2)O[Si]O[Si](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C42H42O2Si3/c1-7-19-37(20-8-1)31-46(32-38-21-9-2-10-22-38,33-39-23-11-3-12-24-39)43-45-44-47(34-40-25-13-4-14-26-40,35-41-27-15-5-16-28-41)36-42-29-17-6-18-30-42/h1-30H,31-36H2 |
| InChIKey | BIDKKNWNNRVTND-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 663.05 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11981400 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11981400?
The IUPAC name of CID 11981400 (CID 11981400) is not available.
What is the SMILES notation for CID 11981400?
The canonical SMILES for CID 11981400 is c1ccc(C[Si](Cc2ccccc2)(Cc2ccccc2)O[Si]O[Si](Cc2ccccc2)(Cc2ccccc2)Cc2ccccc2)cc1.
What is the InChIKey of CID 11981400?
The InChIKey is BIDKKNWNNRVTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H42O2Si3/c1-7-19-37(20-8-1)31-46(32-38-21-9-2-10-22-38,33-39-23-11-3-12-24-39)43-45-44-47(34-40-25-13-4-14-26-40,35-41-27-15-5-16-28-41)36-42-29-17-6-18-30-42/h1-30H,31-36H2.
What are the key properties of CID 11981400?
CID 11981400 has a molecular weight of 663.05 g/mol, XLogP of 9.14, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11981400 is sourced from PubChem (CID 11981400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).