C11H13F3Si — CID 162419783
dimethyl-phenyl-(2,3,3-trifluoroprop-2-enyl)silane (PubChem CID 162419783) has the molecular formula C11H13F3Si and a molecular weight of 230.31 g/mol. Its IUPAC name is dimethyl-phenyl-(2,3,3-trifluoroprop-2-enyl)silane.
| Compound Name | dimethyl-phenyl-(2,3,3-trifluoroprop-2-enyl)silane |
|---|---|
| PubChem CID | 162419783 |
| Molecular Formula | C11H13F3Si |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | dimethyl-phenyl-(2,3,3-trifluoroprop-2-enyl)silane |
| SMILES | C[Si](C)(CC(F)=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H13F3Si/c1-15(2,8-10(12)11(13)14)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | UBUVRPIXYSQMDG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|