C28H58Si8 — CID 12992108
[dimethyl(phenyl)silyl]-[[dimethyl(phenyl)silyl]-bis(trimethylsilyl)silyl]-bis(trimethylsilyl)silane (PubChem CID 12992108) has the molecular formula C28H58Si8 and a molecular weight of 619.46 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl]-[[dimethyl(phenyl)silyl]-bis(trimethylsilyl)silyl]-bis(trimethylsilyl)silane.
| Compound Name | [dimethyl(phenyl)silyl]-[[dimethyl(phenyl)silyl]-bis(trimethylsilyl)silyl]-bis(trimethylsilyl)silane |
|---|---|
| PubChem CID | 12992108 |
| Molecular Formula | C28H58Si8 |
| Molecular Weight | 619.46 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | [dimethyl(phenyl)silyl]-[[dimethyl(phenyl)silyl]-bis(trimethylsilyl)silyl]-bis(trimethylsilyl)silane |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)c1ccccc1)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C28H58Si8/c1-29(2,3)35(30(4,5)6,33(13,14)27-23-19-17-20-24-27)36(31(7,8)9,32(10,11)12)34(15,16)28-25-21-18-22-26-28/h17-26H,1-16H3 |
| InChIKey | VPVJREATYRMDRT-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.46 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|