C13H26O3Si3 — CID 58662902
[dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-phenylsilane (PubChem CID 58662902) has the molecular formula C13H26O3Si3 and a molecular weight of 314.61 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-phenylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-phenylsilane |
|---|---|
| PubChem CID | 58662902 |
| Molecular Formula | C13H26O3Si3 |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-methoxy-methyl-phenylsilane |
| SMILES | CO[Si](C)(O[Si](C)(C)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C13H26O3Si3/c1-14-19(7,13-11-9-8-10-12-13)16-18(5,6)15-17(2,3)4/h8-12H,1-7H3 |
| InChIKey | YUMSKHRNXOCALA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|