About dimethoxy-methyl-phenylsilane;methoxysilane
dimethoxy-methyl-phenylsilane;methoxysilane (PubChem CID 173325239) has the molecular formula C10H20O3Si2
and a molecular weight of 244.44 g/mol. Its IUPAC name is dimethoxy-methyl-phenylsilane;methoxysilane.
Molecular Properties
| Compound Name | dimethoxy-methyl-phenylsilane;methoxysilane |
| PubChem CID | 173325239 |
| Molecular Formula | C10H20O3Si2 |
| Molecular Weight | 244.44 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | dimethoxy-methyl-phenylsilane;methoxysilane |
| SMILES | CO[SiH3].CO[Si](C)(OC)c1ccccc1 |
| InChI | InChI=1S/C9H14O2Si.CH6OSi/c1-10-12(3,11-2)9-7-5-4-6-8-9;1-2-3/h4-8H,1-3H3;1,3H3 |
| InChIKey | NIKVXQUNVIWGDJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.44 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy-methyl-phenylsilane;methoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy-methyl-phenylsilane;methoxysilane?
The IUPAC name of dimethoxy-methyl-phenylsilane;methoxysilane (CID 173325239) is dimethoxy-methyl-phenylsilane;methoxysilane.
What is the SMILES notation for dimethoxy-methyl-phenylsilane;methoxysilane?
The canonical SMILES for dimethoxy-methyl-phenylsilane;methoxysilane is CO[SiH3].CO[Si](C)(OC)c1ccccc1.
What is the InChIKey of dimethoxy-methyl-phenylsilane;methoxysilane?
The InChIKey is NIKVXQUNVIWGDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2Si.CH6OSi/c1-10-12(3,11-2)9-7-5-4-6-8-9;1-2-3/h4-8H,1-3H3;1,3H3.
What are the key properties of dimethoxy-methyl-phenylsilane;methoxysilane?
dimethoxy-methyl-phenylsilane;methoxysilane has a molecular weight of 244.44 g/mol, XLogP of 0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy-methyl-phenylsilane;methoxysilane is sourced from PubChem (CID 173325239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).