C14H26O2Si3 — CID 174350694
[dimethyl(trimethylsilyloxy)silyl]oxy-ethenyl-methyl-phenylsilane (PubChem CID 174350694) has the molecular formula C14H26O2Si3 and a molecular weight of 310.62 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-ethenyl-methyl-phenylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-ethenyl-methyl-phenylsilane |
|---|---|
| PubChem CID | 174350694 |
| Molecular Formula | C14H26O2Si3 |
| Molecular Weight | 310.62 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-ethenyl-methyl-phenylsilane |
| SMILES | C=C[Si](C)(O[Si](C)(C)O[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C14H26O2Si3/c1-8-19(7,14-12-10-9-11-13-14)16-18(5,6)15-17(2,3)4/h8-13H,1H2,2-7H3 |
| InChIKey | GYOARWYNVDNIOC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.62 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|