C32H38O3Si4 — CID 58556684
ethenyl-[[(ethenyl-methyl-phenylsilyl)oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-methyl-phenylsilane (PubChem CID 58556684) has the molecular formula C32H38O3Si4 and a molecular weight of 583.00 g/mol. Its IUPAC name is ethenyl-[[(ethenyl-methyl-phenylsilyl)oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-methyl-phenylsilane.
| Compound Name | ethenyl-[[(ethenyl-methyl-phenylsilyl)oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-methyl-phenylsilane |
|---|---|
| PubChem CID | 58556684 |
| Molecular Formula | C32H38O3Si4 |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | ethenyl-[[(ethenyl-methyl-phenylsilyl)oxy-dimethylsilyl]oxy-diphenylsilyl]oxy-methyl-phenylsilane |
| SMILES | C=C[Si](C)(O[Si](C)(C)O[Si](O[Si](C)(C=C)c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38O3Si4/c1-7-37(5,29-21-13-9-14-22-29)33-36(3,4)34-39(31-25-17-11-18-26-31,32-27-19-12-20-28-32)35-38(6,8-2)30-23-15-10-16-24-30/h7-28H,1-2H2,3-6H3 |
| InChIKey | RKFQHJKIBQZPKI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|