C15H16O — CID 143297607
(2E,4E,5Z)-4-ethylidene-1-phenylhepta-2,5-dien-1-one (PubChem CID 143297607) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is (2E,4E,5Z)-4-ethylidene-1-phenylhepta-2,5-dien-1-one.
| Compound Name | (2E,4E,5Z)-4-ethylidene-1-phenylhepta-2,5-dien-1-one |
|---|---|
| PubChem CID | 143297607 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2E,4E,5Z)-4-ethylidene-1-phenylhepta-2,5-dien-1-one |
| SMILES | C/C=C\C(\C=C\C(=O)c1ccccc1)=C/C |
| InChI | InChI=1S/C15H16O/c1-3-8-13(4-2)11-12-15(16)14-9-6-5-7-10-14/h3-12H,1-2H3/b8-3-,12-11+,13-4+ |
| InChIKey | BEERIRCKWWBWHK-BMJLEBTISA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|