C18H16O4 — CID 143019370
3-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienoyl]-4-hydroxychromen-2-one (PubChem CID 143019370) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienoyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienoyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 143019370 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[(2E,4E,5Z)-4-ethylidenehepta-2,5-dienoyl]-4-hydroxychromen-2-one |
| SMILES | C/C=C\C(\C=C\C(=O)c1c(O)c2ccccc2oc1=O)=C/C |
| InChI | InChI=1S/C18H16O4/c1-3-7-12(4-2)10-11-14(19)16-17(20)13-8-5-6-9-15(13)22-18(16)21/h3-11,20H,1-2H3/b7-3-,11-10+,12-4+ |
| InChIKey | WEELGMAVVASOSV-RUHUQFOKSA-N |
| XLogP | 3.76 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|