C19H12O6 — CID 54715835
3-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-4-hydroxychromen-2-one (PubChem CID 54715835) has the molecular formula C19H12O6 and a molecular weight of 336.30 g/mol. Its IUPAC name is 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-4-hydroxychromen-2-one.
| Compound Name | 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-4-hydroxychromen-2-one |
|---|---|
| PubChem CID | 54715835 |
| Molecular Formula | C19H12O6 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 3-[3-(1,3-benzodioxol-5-yl)prop-2-enoyl]-4-hydroxychromen-2-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)c1c(O)c2ccccc2oc1=O |
| InChI | InChI=1S/C19H12O6/c20-13(7-5-11-6-8-15-16(9-11)24-10-23-15)17-18(21)12-3-1-2-4-14(12)25-19(17)22/h1-9,21H,10H2 |
| InChIKey | ATWNXRSRCRKYKH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|