C22H28OSi — CID 134947259
(1E,3S,4R,6E)-1-[dimethyl(phenyl)silyl]-3-methyl-7-phenylhepta-1,6-dien-4-ol (PubChem CID 134947259) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol. Its IUPAC name is (1E,3S,4R,6E)-1-[dimethyl(phenyl)silyl]-3-methyl-7-phenylhepta-1,6-dien-4-ol.
| Compound Name | (1E,3S,4R,6E)-1-[dimethyl(phenyl)silyl]-3-methyl-7-phenylhepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 134947259 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (1E,3S,4R,6E)-1-[dimethyl(phenyl)silyl]-3-methyl-7-phenylhepta-1,6-dien-4-ol |
| SMILES | C[C@@H](/C=C/[Si](C)(C)c1ccccc1)[C@H](O)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H28OSi/c1-19(17-18-24(2,3)21-14-8-5-9-15-21)22(23)16-10-13-20-11-6-4-7-12-20/h4-15,17-19,22-23H,16H2,1-3H3/b13-10+,18-17+/t19-,22+/m0/s1 |
| InChIKey | KORMXOJHKNTWPT-MXMAXJAMSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|