C21H28SiSn — CID 177410764
dimethyl-phenyl-[(1Z,3E)-4-phenyl-2-trimethylstannylbuta-1,3-dienyl]silane (PubChem CID 177410764) has the molecular formula C21H28SiSn and a molecular weight of 427.25 g/mol. Its IUPAC name is dimethyl-phenyl-[(1Z,3E)-4-phenyl-2-trimethylstannylbuta-1,3-dienyl]silane.
| Compound Name | dimethyl-phenyl-[(1Z,3E)-4-phenyl-2-trimethylstannylbuta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 177410764 |
| Molecular Formula | C21H28SiSn |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | dimethyl-phenyl-[(1Z,3E)-4-phenyl-2-trimethylstannylbuta-1,3-dienyl]silane |
| SMILES | C[Si](C)(/C=C(/C=C/c1ccccc1)[Sn](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H19Si.3CH3.Sn/c1-19(2,18-14-7-4-8-15-18)16-10-9-13-17-11-5-3-6-12-17;;;;/h3-9,11-16H,1-2H3;3*1H3;/b13-9+,16-10?;;;; |
| InChIKey | YEOHNTZTJBBHJT-NDSOGTPUSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|