C19H15NO2 — CID 54410030
3,4-dibenzylidene-1-methylpyrrolidine-2,5-dione (PubChem CID 54410030) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is 3,4-dibenzylidene-1-methylpyrrolidine-2,5-dione.
| Compound Name | 3,4-dibenzylidene-1-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54410030 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3,4-dibenzylidene-1-methylpyrrolidine-2,5-dione |
| SMILES | CN1C(=O)C(=Cc2ccccc2)C(=Cc2ccccc2)C1=O |
| InChI | InChI=1S/C19H15NO2/c1-20-18(21)16(12-14-8-4-2-5-9-14)17(19(20)22)13-15-10-6-3-7-11-15/h2-13H,1H3 |
| InChIKey | VTLPHSLIIYSYPV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|