C16H10FNO3 — CID 112979206
(3E)-3-[(3-fluorophenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid (PubChem CID 112979206) has the molecular formula C16H10FNO3 and a molecular weight of 283.26 g/mol. Its IUPAC name is (3E)-3-[(3-fluorophenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid.
| Compound Name | (3E)-3-[(3-fluorophenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid |
|---|---|
| PubChem CID | 112979206 |
| Molecular Formula | C16H10FNO3 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | (3E)-3-[(3-fluorophenyl)methylidene]-2-oxo-1H-indole-5-carboxylic acid |
| SMILES | O=C1Nc2ccc(C(=O)O)cc2/C1=C\c1cccc(F)c1 |
| InChI | InChI=1S/C16H10FNO3/c17-11-3-1-2-9(6-11)7-13-12-8-10(16(20)21)4-5-14(12)18-15(13)19/h1-8H,(H,18,19)(H,20,21)/b13-7+ |
| InChIKey | ASLJCSFOFGXLIC-NTUHNPAUSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|